cas: 842113-96-6 — see every product listed under this CAS number, including other names
Benzamide, 2-(acetyloxy)-N-(4-bromo-2-chlorophenyl)-, 95%, 95% (CAS 842113-96-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JQ8Z-100mg |
| cas | 842113-96-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[2-[(4-bromo-2-chlorophenyl)carbamoyl]phenyl] acetate (CAS 842113-96-6) is a chemical compound with the molecular formula C15H11BrClNO3 and a molecular weight of 368.61 g/mol. IUPAC name: [2-[(4-bromo-2-chlorophenyl)carbamoyl]phenyl] acetate. InChIKey: ZDGFVLLIMNDIBK-UHFFFAOYSA-N.
| Molecular formula | C15H11BrClNO3 |
|---|---|
| Molecular weight | 368.61 g/mol |
| IUPAC name | [2-[(4-bromo-2-chlorophenyl)carbamoyl]phenyl] acetate |
| InChIKey | ZDGFVLLIMNDIBK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)NC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)