CAS 842113-96-6 appears in our catalog under these names: 2-((4-Bromo-2-chlorophenyl)carbamoyl)phenyl acetate, 95%, Benzamide, 2-(acetyloxy)-N-(4-bromo-2-chlorophenyl)-, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
[2-[(4-bromo-2-chlorophenyl)carbamoyl]phenyl] acetate (CAS 842113-96-6) is a chemical compound with the molecular formula C15H11BrClNO3 and a molecular weight of 368.61 g/mol. IUPAC name: [2-[(4-bromo-2-chlorophenyl)carbamoyl]phenyl] acetate. InChIKey: ZDGFVLLIMNDIBK-UHFFFAOYSA-N.
| Molecular formula | C15H11BrClNO3 |
|---|---|
| Molecular weight | 368.61 g/mol |
| IUPAC name | [2-[(4-bromo-2-chlorophenyl)carbamoyl]phenyl] acetate |
| InChIKey | ZDGFVLLIMNDIBK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)NC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)