CAS 93-98-1 appears in our catalog under these names: Benzanilide, 98%, 98%, Benzanilide, 98+% , Benzanilide, 98%, Benzanilide 98%, N-Phenylbenzamide, 98%. Offered by: Chemat, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 1KG, 250g, 1000g.
N-phenylbenzamide (CAS 93-98-1) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: N-phenylbenzamide. InChIKey: ZVSKZLHKADLHSD-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | N-phenylbenzamide |
| InChIKey | ZVSKZLHKADLHSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)