cas: 61326-44-1 — see every product listed under this CAS number, including other names
Benzene, 1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-bromo-, 97%, 97% (CAS 61326-44-1) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKF5-1kg |
| cas | 61326-44-1 |
| size | 1kg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 9035.60 Pln | |
| Chemat | 5kg | 38126.40 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 25g | 434.00 Pln | |
| Chemat | 50g | 803.60 Pln | |
| Chemat | 500g | 5678.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-[1,2,2-tris(4-bromophenyl)ethenyl]benzene (CAS 61326-44-1) is a chemical compound with the molecular formula C26H16Br4 and a molecular weight of 648.0 g/mol. IUPAC name: 1-bromo-4-[1,2,2-tris(4-bromophenyl)ethenyl]benzene. InChIKey: BIRLDGKMJJEZRI-UHFFFAOYSA-N.
| Molecular formula | C26H16Br4 |
|---|---|
| Molecular weight | 648.0 g/mol |
| IUPAC name | 1-bromo-4-[1,2,2-tris(4-bromophenyl)ethenyl]benzene |
| InChIKey | BIRLDGKMJJEZRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=C(C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)Br |
Computed by PubChem (NCBI)