CAS 2361216-82-0 is the registry number for 1,1,2,2-Tetrakis(3-bromophenyl)ethene, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1-bromo-3-[1,2,2-tris(3-bromophenyl)ethenyl]benzene (CAS 2361216-82-0) is a chemical compound with the molecular formula C26H16Br4 and a molecular weight of 648.0 g/mol. IUPAC name: 1-bromo-3-[1,2,2-tris(3-bromophenyl)ethenyl]benzene. InChIKey: HOKLGBCCRZXEGO-UHFFFAOYSA-N.
| Molecular formula | C26H16Br4 |
|---|---|
| Molecular weight | 648.0 g/mol |
| IUPAC name | 1-bromo-3-[1,2,2-tris(3-bromophenyl)ethenyl]benzene |
| InChIKey | HOKLGBCCRZXEGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=C(C2=CC(=CC=C2)Br)C3=CC(=CC=C3)Br)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)