cas: 134882-63-6 — see every product listed under this CAS number, including other names
Benzene, 1-fluoro-4-methoxy-5-methyl-2-nitro-, 98%, 98% (CAS 134882-63-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HTSL-100mg |
| cas | 134882-63-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 803.60 Pln | |
| Chemat | 5g | 2853.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-fluoro-4-methoxy-5-methyl-2-nitrobenzene (CAS 134882-63-6) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 1-fluoro-4-methoxy-5-methyl-2-nitrobenzene. InChIKey: ANTUPTYBGAWYGM-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 1-fluoro-4-methoxy-5-methyl-2-nitrobenzene |
| InChIKey | ANTUPTYBGAWYGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)[N+](=O)[O-])F |
Computed by PubChem (NCBI)