cas: 903580-39-2 — see every product listed under this CAS number, including other names
Benzenemethanamine, 5-chloro-2,3-dimethoxy-α-methyl-N-[2-(methylsulfonyl)-5-(1-piperazinyl)phenyl]-, monohydrochloride, 98%, 98% (CAS 903580-39-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNLR-25mg |
| cas | 903580-39-2 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 750.80 Pln | |
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2680.40 Pln | |
| Chemat | 1g | 7643.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline;hydrochloride (CAS 903580-39-2) is a chemical compound with the molecular formula C21H29Cl2N3O4S and a molecular weight of 490.4 g/mol. IUPAC name: N-[1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline;hydrochloride. InChIKey: PILCQJJJAFRKHO-UHFFFAOYSA-N.
| Molecular formula | C21H29Cl2N3O4S |
|---|---|
| Molecular weight | 490.4 g/mol |
| IUPAC name | N-[1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline;hydrochloride |
| InChIKey | PILCQJJJAFRKHO-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC(=C1)Cl)OC)OC)NC2=C(C=CC(=C2)N3CCNCC3)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)