CAS 903580-39-2 appears in our catalog under these names: Prx 07034, 95%, PRX-07034 HCl, 97%, PRX 07034, PRX-07034 hydrochloride/ 99.17% (existing batch purity), PRX 07034. Offered by: Combi-blocks, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 10mg, 50mg, 5mg, 25mg, 200mg.
N-[1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline;hydrochloride (CAS 903580-39-2) is a chemical compound with the molecular formula C21H29Cl2N3O4S and a molecular weight of 490.4 g/mol. IUPAC name: N-[1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline;hydrochloride. InChIKey: PILCQJJJAFRKHO-UHFFFAOYSA-N.
| Molecular formula | C21H29Cl2N3O4S |
|---|---|
| Molecular weight | 490.4 g/mol |
| IUPAC name | N-[1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline;hydrochloride |
| InChIKey | PILCQJJJAFRKHO-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC(=C1)Cl)OC)OC)NC2=C(C=CC(=C2)N3CCNCC3)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)