cas: 919354-04-4 — see every product listed under this CAS number, including other names
Benzenemethanesulfonamide, 3-bromo-, 98%, 98% (CAS 919354-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BHAQ-100mg |
| cas | 919354-04-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 2752.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-bromophenyl)methanesulfonamide (CAS 919354-04-4) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: (3-bromophenyl)methanesulfonamide. InChIKey: NZPHFPJATRGGMD-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (3-bromophenyl)methanesulfonamide |
| InChIKey | NZPHFPJATRGGMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CS(=O)(=O)N |
Computed by PubChem (NCBI)