cas: 1191030-88-2 — see every product listed under this CAS number, including other names
Benzo[b]furan-7-sulfonyl chloride, 97% (CAS 1191030-88-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC78203DA |
| cas | 1191030-88-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 1664.69 Pln | |
| Thermo Scientific | 5g | 2677.76 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-benzofuran-7-sulfonyl chloride (CAS 1191030-88-2) is a chemical compound with the molecular formula C8H5ClO3S and a molecular weight of 216.64 g/mol. IUPAC name: 1-benzofuran-7-sulfonyl chloride. InChIKey: MEOOVUNNRYYGCV-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3S |
|---|---|
| Molecular weight | 216.64 g/mol |
| IUPAC name | 1-benzofuran-7-sulfonyl chloride |
| InChIKey | MEOOVUNNRYYGCV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)Cl)OC=C2 |
Computed by PubChem (NCBI)