cas: 15884-65-8 — see every product listed under this CAS number, including other names
Benzo[d][1,3]dioxole-5-carbothioamide, 98%, 98% (CAS 15884-65-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QXC-100mg |
| cas | 15884-65-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 774.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-benzodioxole-5-carbothioamide (CAS 15884-65-8) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 1,3-benzodioxole-5-carbothioamide. InChIKey: YHXXBQMLJHUUJU-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 1,3-benzodioxole-5-carbothioamide |
| InChIKey | YHXXBQMLJHUUJU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=S)N |
Computed by PubChem (NCBI)