Benzofuran-2-carbonyl chloride 95%
cas: 41717-28-6 — see every product listed under this CAS number, including other names
Benzofuran-2-carbonyl chloride 95% (CAS 41717-28-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A624914-100mg |
| cas | 41717-28-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 648.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A624914 |
1-benzofuran-2-carbonyl chloride (CAS 41717-28-6) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 1-benzofuran-2-carbonyl chloride. InChIKey: ZJDRDTZQVOCKPI-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 1-benzofuran-2-carbonyl chloride |
| InChIKey | ZJDRDTZQVOCKPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Coumariloyl chloride, Coumarilic acid chloride, 4-18-00-04248 (Beilstein Handbook Reference), Benzofuran-2-carbonyl chloride, 1-benzofuran-2-carbonyl chloride, benzo[b]furan-2-carbonyl chloride, Benzofuran-2-carbonylchloride, Benzofuran -2-carbonyl chloride, 2-benzofurancarboxylic acid chloride, benzofuran-2-carboxylic acid chloride