CAS 111964-21-7 appears in our catalog under these names: Benzo[b]furan-3-carbonyl chloride, 95%, Benzofuran-3-carbonyl chloride, 97%, 97%, Benzofuran-3-carbonyl chloride, 97%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.
1-benzofuran-3-carbonyl chloride (CAS 111964-21-7) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 1-benzofuran-3-carbonyl chloride. InChIKey: YUHWSRVMUQSCNL-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 1-benzofuran-3-carbonyl chloride |
| InChIKey | YUHWSRVMUQSCNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CO2)C(=O)Cl |
Computed by PubChem (NCBI)