cas: 1432610-21-3 — see every product listed under this CAS number, including other names
Benzofuran-7-boronic acid 98% (CAS 1432610-21-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754594-100mg |
| cas | 1432610-21-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1093.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A754594 |
1-benzofuran-7-ylboronic acid (CAS 1432610-21-3) is a chemical compound with the molecular formula C8H7BO3 and a molecular weight of 161.95 g/mol. IUPAC name: 1-benzofuran-7-ylboronic acid. InChIKey: GCDOPNZOLYBYNO-UHFFFAOYSA-N.
| Molecular formula | C8H7BO3 |
|---|---|
| Molecular weight | 161.95 g/mol |
| IUPAC name | 1-benzofuran-7-ylboronic acid |
| InChIKey | GCDOPNZOLYBYNO-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CO2)(O)O |
Computed by PubChem (NCBI)