cas: 1432610-21-3 — see every product listed under this CAS number, including other names
Boronic acid, B-7-benzofuranyl-, 98%, 98% (CAS 1432610-21-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WS0-100mg |
| cas | 1432610-21-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 698.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-benzofuran-7-ylboronic acid (CAS 1432610-21-3) is a chemical compound with the molecular formula C8H7BO3 and a molecular weight of 161.95 g/mol. IUPAC name: 1-benzofuran-7-ylboronic acid. InChIKey: GCDOPNZOLYBYNO-UHFFFAOYSA-N.
| Molecular formula | C8H7BO3 |
|---|---|
| Molecular weight | 161.95 g/mol |
| IUPAC name | 1-benzofuran-7-ylboronic acid |
| InChIKey | GCDOPNZOLYBYNO-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CO2)(O)O |
Computed by PubChem (NCBI)