cas: 1341291-68-6 — see every product listed under this CAS number, including other names
Benzoic acid, 3-amino-5-bromo-4-iodo-, methyl ester, 95%+, 95%+ (CAS 1341291-68-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPKV-100mg |
| cas | 1341291-68-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1802.00 Pln | |
| Chemat | 10g | 3275.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-5-bromo-4-iodobenzoate (CAS 1341291-68-6) is a chemical compound with the molecular formula C8H7BrINO2 and a molecular weight of 355.95 g/mol. IUPAC name: methyl 3-amino-5-bromo-4-iodobenzoate. InChIKey: OGHWAKOHMJJNPZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrINO2 |
|---|---|
| Molecular weight | 355.95 g/mol |
| IUPAC name | methyl 3-amino-5-bromo-4-iodobenzoate |
| InChIKey | OGHWAKOHMJJNPZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)I)N |
Computed by PubChem (NCBI)