CAS 1820641-86-8 is the registry number for 2-Amino-4-bromo-5-iodo-benzoic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Methyl 2-amino-4-bromo-5-iodobenzoate (CAS 1820641-86-8) is a chemical compound with the molecular formula C8H7BrINO2 and a molecular weight of 355.95 g/mol. IUPAC name: methyl 2-amino-4-bromo-5-iodobenzoate. InChIKey: WSALXGZBDVNFLR-UHFFFAOYSA-N.
| Molecular formula | C8H7BrINO2 |
|---|---|
| Molecular weight | 355.95 g/mol |
| IUPAC name | methyl 2-amino-4-bromo-5-iodobenzoate |
| InChIKey | WSALXGZBDVNFLR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)Br)I |
Computed by PubChem (NCBI)