Products 1820641-86-8

CAS 1820641-86-8 is the registry number for 2-Amino-4-bromo-5-iodo-benzoic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-4-bromo-5-iodobenzoate (CAS 1820641-86-8) is a chemical compound with the molecular formula C8H7BrINO2 and a molecular weight of 355.95 g/mol. IUPAC name: methyl 2-amino-4-bromo-5-iodobenzoate. InChIKey: WSALXGZBDVNFLR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrINO2
Molecular weight355.95 g/mol
IUPAC namemethyl 2-amino-4-bromo-5-iodobenzoate
InChIKeyWSALXGZBDVNFLR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1N)Br)I

Computed by PubChem (NCBI)