cas: 913835-93-5 — see every product listed under this CAS number, including other names
Benzoic acid, 3-borono-4-chloro-, 1-ethyl ester, 98%, 98% (CAS 913835-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117NKA-100mg |
| cas | 913835-93-5 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1557.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-chloro-5-ethoxycarbonylphenyl)boronic acid (CAS 913835-93-5) is a chemical compound with the molecular formula C9H10BClO4 and a molecular weight of 228.44 g/mol. IUPAC name: (2-chloro-5-ethoxycarbonylphenyl)boronic acid. InChIKey: MWOJXHPAEOGJPL-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO4 |
|---|---|
| Molecular weight | 228.44 g/mol |
| IUPAC name | (2-chloro-5-ethoxycarbonylphenyl)boronic acid |
| InChIKey | MWOJXHPAEOGJPL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)OCC)Cl)(O)O |
Computed by PubChem (NCBI)