CAS 913835-93-5 appears in our catalog under these names: Ethyl 3-borono-4-chlorobenzoate, 98%, (2-Chloro-5-(ethoxycarbonyl)phenyl)boronic acid 98%, Benzoic acid, 3-borono-4-chloro-, 1-ethyl ester, 98%, 98%, (2-Chloro-5-(ethoxycarbonyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 100g, 100mg.
(2-chloro-5-ethoxycarbonylphenyl)boronic acid (CAS 913835-93-5) is a chemical compound with the molecular formula C9H10BClO4 and a molecular weight of 228.44 g/mol. IUPAC name: (2-chloro-5-ethoxycarbonylphenyl)boronic acid. InChIKey: MWOJXHPAEOGJPL-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO4 |
|---|---|
| Molecular weight | 228.44 g/mol |
| IUPAC name | (2-chloro-5-ethoxycarbonylphenyl)boronic acid |
| InChIKey | MWOJXHPAEOGJPL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)OCC)Cl)(O)O |
Computed by PubChem (NCBI)