cas: 3368-13-6 — see every product listed under this CAS number, including other names
Benzolamide 97% (CAS 3368-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A906540-100mg |
| cas | 3368-13-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1304.88 Pln | |
| Ambeed | 250mg | 1922.31 Pln | |
| Ambeed | 1g | 4692.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A906540 |
5-(benzenesulfonamido)-1,3,4-thiadiazole-2-sulfonamide (CAS 3368-13-6) is a chemical compound with the molecular formula C8H8N4O4S3 and a molecular weight of 320.4 g/mol. IUPAC name: 5-(benzenesulfonamido)-1,3,4-thiadiazole-2-sulfonamide. InChIKey: PWDGTQXZLNDOKS-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O4S3 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 5-(benzenesulfonamido)-1,3,4-thiadiazole-2-sulfonamide |
| InChIKey | PWDGTQXZLNDOKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=NN=C(S2)S(=O)(=O)N |
Computed by PubChem (NCBI)