cas: 1932063-48-3 — see every product listed under this CAS number, including other names
Benzyl ((1R,3S)-3-aminocyclohexyl)carbamate, 98% (CAS 1932063-48-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608618-50MG |
| cas | 1932063-48-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 919.49 Pln | |
| Fluorochem | 100mg | 1518.23 Pln | |
| Fluorochem | 250mg | 2981.26 Pln | |
| Fluorochem | 1g | 6495.65 Pln | |
| Fluorochem | 5g | 19376.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate (CAS 1932063-48-3) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate. InChIKey: NFWZARAFTINKJK-QWHCGFSZSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate |
| InChIKey | NFWZARAFTINKJK-QWHCGFSZSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)NC(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)