cas: 1932063-48-3 — see every product listed under this CAS number, including other names
Benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate, 98%, 98% (CAS 1932063-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EN9-100mg |
| cas | 1932063-48-3 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1710.80 Pln | |
| Chemat | 250mg | 2526.80 Pln | |
| Chemat | 1g | 5013.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate (CAS 1932063-48-3) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate. InChIKey: NFWZARAFTINKJK-QWHCGFSZSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate |
| InChIKey | NFWZARAFTINKJK-QWHCGFSZSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)NC(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)