cas: 672310-23-5 — see every product listed under this CAS number, including other names
Benzyl (2-((S)-3-hydroxypyrrolidin-1-yl)-1-phenylethyl)(methyl)carbamate, 98% (CAS 672310-23-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A315278-1g |
| cas | 672310-23-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4887.40 Pln | |
| AmBeed | 250mg | 2016.49 Pln | |
| AmBeed | 5g | 11469.01 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methylcarbamate (CAS 672310-23-5) is a chemical compound with the molecular formula C21H26N2O3 and a molecular weight of 354.4 g/mol. IUPAC name: benzyl N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methylcarbamate. InChIKey: XXJCJEOBWAOPCT-VQTJNVASSA-N.
| Molecular formula | C21H26N2O3 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | benzyl N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methylcarbamate |
| InChIKey | XXJCJEOBWAOPCT-VQTJNVASSA-N |
| SMILES | CN([C@H](CN1CC[C@@H](C1)O)C2=CC=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)