Products 182684-39-5

CAS 182684-39-5 is the registry number for N-Butyl L-Z-Phenylalaninamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 182684-39-5) is a chemical compound with the molecular formula C21H26N2O3 and a molecular weight of 354.4 g/mol. IUPAC name: benzyl N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: RRULNKHHKRADQB-UHFFFAOYSA-N.

Identity
Molecular formulaC21H26N2O3
Molecular weight354.4 g/mol
IUPAC namebenzyl N-[1-(butylamino)-1-oxo-3-phenylpropan-2-yl]carbamate
InChIKeyRRULNKHHKRADQB-UHFFFAOYSA-N
SMILESCCCCNC(=O)C(CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)