cas: 1256633-39-2 — see every product listed under this CAS number, including other names
Benzyl (3-bromo-4-fluorophenyl)carbamate (CAS 1256633-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F432192-100MG |
| cas | 1256633-39-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 1190.22 Pln | |
| Fluorochem | 10g | 1846.24 Pln | |
| Fluorochem | 25g | 3017.71 Pln | |
| Fluorochem | 100g | 7734.79 Pln |
| delivery time | 3-4 weeks |
|---|
Benzyl N-(3-bromo-4-fluorophenyl)carbamate (CAS 1256633-39-2) is a chemical compound with the molecular formula C14H11BrFNO2 and a molecular weight of 324.14 g/mol. IUPAC name: benzyl N-(3-bromo-4-fluorophenyl)carbamate. InChIKey: AVLKMUXJCIPDEQ-UHFFFAOYSA-N.
| Molecular formula | C14H11BrFNO2 |
|---|---|
| Molecular weight | 324.14 g/mol |
| IUPAC name | benzyl N-(3-bromo-4-fluorophenyl)carbamate |
| InChIKey | AVLKMUXJCIPDEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=C(C=C2)F)Br |
Computed by PubChem (NCBI)