cas: 1256633-39-2 — see every product listed under this CAS number, including other names
N-Cbz-3-bromo-4-fluoroaniline, >95%, >95% (CAS 1256633-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OB1-100mg |
| cas | 1256633-39-2 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Chemat | 10g | 1130.00 Pln | |
| Chemat | 25g | 1840.40 Pln | |
| Chemat | 100g | 4686.80 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(3-bromo-4-fluorophenyl)carbamate (CAS 1256633-39-2) is a chemical compound with the molecular formula C14H11BrFNO2 and a molecular weight of 324.14 g/mol. IUPAC name: benzyl N-(3-bromo-4-fluorophenyl)carbamate. InChIKey: AVLKMUXJCIPDEQ-UHFFFAOYSA-N.
| Molecular formula | C14H11BrFNO2 |
|---|---|
| Molecular weight | 324.14 g/mol |
| IUPAC name | benzyl N-(3-bromo-4-fluorophenyl)carbamate |
| InChIKey | AVLKMUXJCIPDEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=C(C=C2)F)Br |
Computed by PubChem (NCBI)