cas: 1218791-13-9 — see every product listed under this CAS number, including other names
Benzyl (3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 97% (CAS 1218791-13-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447554-1G |
| cas | 1218791-13-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 414.46 Pln | |
| Fluorochem | 25g | 570.65 Pln | |
| Fluorochem | 100g | 2096.15 Pln | |
| Fluorochem | 500g | 10244.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1218791-13-9) is a chemical compound with the molecular formula C20H23BFNO4 and a molecular weight of 371.2 g/mol. IUPAC name: benzyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: XPCYDSDRORRCFT-UHFFFAOYSA-N.
| Molecular formula | C20H23BFNO4 |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | benzyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | XPCYDSDRORRCFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)