CAS 1256359-14-4 is the registry number for 3-(Benzyloxycarbonylamino)-4-fluorophenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
Benzyl N-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1256359-14-4) is a chemical compound with the molecular formula C20H23BFNO4 and a molecular weight of 371.2 g/mol. IUPAC name: benzyl N-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: NSRXSBHAUAOESX-UHFFFAOYSA-N.
| Molecular formula | C20H23BFNO4 |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | benzyl N-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | NSRXSBHAUAOESX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)