cas: 2096997-12-3 — see every product listed under this CAS number, including other names
Benzyl (3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate 97% (CAS 2096997-12-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A221375-250mg |
| cas | 2096997-12-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 648.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A221375 |
Benzyl N-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 2096997-12-3) is a chemical compound with the molecular formula C20H23BFNO4 and a molecular weight of 371.2 g/mol. IUPAC name: benzyl N-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: MGUIBIHKMSUVJX-UHFFFAOYSA-N.
| Molecular formula | C20H23BFNO4 |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | benzyl N-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | MGUIBIHKMSUVJX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)