cas: 635311-42-1 — see every product listed under this CAS number, including other names
Benzyl (3-oxocyclopentyl)carbamate 97% (CAS 635311-42-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A538089-250mg |
| cas | 635311-42-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A538089 |
Benzyl N-(3-oxocyclopentyl)carbamate (CAS 635311-42-1) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: benzyl N-(3-oxocyclopentyl)carbamate. InChIKey: KCMRCKOQBAJKAG-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | benzyl N-(3-oxocyclopentyl)carbamate |
| InChIKey | KCMRCKOQBAJKAG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CC1NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)