cas: 1259064-47-5 — see every product listed under this CAS number, including other names
Benzyl (4-bromo-2-chlorophenyl)carbamate 98% (CAS 1259064-47-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A694544-250mg |
| cas | 1259064-47-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 437.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A694544 |
Benzyl N-(4-bromo-2-chlorophenyl)carbamate (CAS 1259064-47-5) is a chemical compound with the molecular formula C14H11BrClNO2 and a molecular weight of 340.60 g/mol. IUPAC name: benzyl N-(4-bromo-2-chlorophenyl)carbamate. InChIKey: OBPQJTHMZBDDNQ-UHFFFAOYSA-N.
| Molecular formula | C14H11BrClNO2 |
|---|---|
| Molecular weight | 340.60 g/mol |
| IUPAC name | benzyl N-(4-bromo-2-chlorophenyl)carbamate |
| InChIKey | OBPQJTHMZBDDNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)