CAS 127792-23-8 appears in our catalog under these names: Diclofenac EP Impurity D, Diclofenac Impurity 1(Diclofenac EP Impurity D), 2-(2-((2-Bromo-6-chlorophenyl)amino)phenyl)acetic Acid, (2-((2-Bromo-6-chlorophenyl)amino)phenyl)acetic acid, 2-(2-((2-Bromo-6-chlorophenyl)amino)phenyl)acetic acid 98%. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Biosynth, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-[2-(2-bromo-6-chloroanilino)phenyl]acetic acid (CAS 127792-23-8) is a chemical compound with the molecular formula C14H11BrClNO2 and a molecular weight of 340.60 g/mol. IUPAC name: 2-[2-(2-bromo-6-chloroanilino)phenyl]acetic acid. InChIKey: RABKUCPRNJPBRH-UHFFFAOYSA-N.
| Molecular formula | C14H11BrClNO2 |
|---|---|
| Molecular weight | 340.60 g/mol |
| IUPAC name | 2-[2-(2-bromo-6-chloroanilino)phenyl]acetic acid |
| InChIKey | RABKUCPRNJPBRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=CC=C2Br)Cl |
Computed by PubChem (NCBI)