cas: 510729-01-8 — see every product listed under this CAS number, including other names
Benzyl (4-bromo-3-fluorophenyl)carbamate 97% (CAS 510729-01-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145669-1g |
| cas | 510729-01-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 25g | 1193.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A145669 |
Benzyl N-(4-bromo-3-fluorophenyl)carbamate (CAS 510729-01-8) is a chemical compound with the molecular formula C14H11BrFNO2 and a molecular weight of 324.14 g/mol. IUPAC name: benzyl N-(4-bromo-3-fluorophenyl)carbamate. InChIKey: UPTMRBYILBFUPA-UHFFFAOYSA-N.
| Molecular formula | C14H11BrFNO2 |
|---|---|
| Molecular weight | 324.14 g/mol |
| IUPAC name | benzyl N-(4-bromo-3-fluorophenyl)carbamate |
| InChIKey | UPTMRBYILBFUPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)