cas: 510729-01-8 — see every product listed under this CAS number, including other names
Benzyl (4-bromo-3-fluorophenyl)carbamate, 97%, 97% (CAS 510729-01-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 200g, 300g, 400g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBKX-5g |
| cas | 510729-01-8 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 395.60 Pln | |
| Chemat | 200g | 693.20 Pln | |
| Chemat | 300g | 1000.40 Pln | |
| Chemat | 400g | 1302.80 Pln | |
| Chemat | 500g | 1622.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(4-bromo-3-fluorophenyl)carbamate (CAS 510729-01-8) is a chemical compound with the molecular formula C14H11BrFNO2 and a molecular weight of 324.14 g/mol. IUPAC name: benzyl N-(4-bromo-3-fluorophenyl)carbamate. InChIKey: UPTMRBYILBFUPA-UHFFFAOYSA-N.
| Molecular formula | C14H11BrFNO2 |
|---|---|
| Molecular weight | 324.14 g/mol |
| IUPAC name | benzyl N-(4-bromo-3-fluorophenyl)carbamate |
| InChIKey | UPTMRBYILBFUPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)