cas: 149423-77-8 — see every product listed under this CAS number, including other names
Benzyl (trans-4-aminocyclohexyl)carbamate 97% (CAS 149423-77-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190877-250mg |
| cas | 149423-77-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 987.81 Pln | |
| Ambeed | 10g | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A190877 |
Benzyl N-(4-aminocyclohexyl)carbamate (CAS 149423-77-8) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-(4-aminocyclohexyl)carbamate. InChIKey: JQVBZZUMWRXDSQ-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-(4-aminocyclohexyl)carbamate |
| InChIKey | JQVBZZUMWRXDSQ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)