cas: 885278-83-1 — see every product listed under this CAS number, including other names
Benzyl 3,5-dimethylpiperazine-1-carboxylate 95% (CAS 885278-83-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A815220-100mg |
| cas | 885278-83-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1722.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A815220 |
Benzyl 3,5-dimethylpiperazine-1-carboxylate (CAS 885278-83-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl 3,5-dimethylpiperazine-1-carboxylate. InChIKey: XYDSFNOXAYIVAR-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl 3,5-dimethylpiperazine-1-carboxylate |
| InChIKey | XYDSFNOXAYIVAR-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(N1)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)