cas: 885278-83-1 — see every product listed under this CAS number, including other names
Benzyl 3,5-dimethylpiperazine-1-carboxylate, 95%, 95% (CAS 885278-83-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTU8-100mg |
| cas | 885278-83-1 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 506.00 Pln | |
| Chemat | 5g | 1538.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3,5-dimethylpiperazine-1-carboxylate (CAS 885278-83-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl 3,5-dimethylpiperazine-1-carboxylate. InChIKey: XYDSFNOXAYIVAR-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl 3,5-dimethylpiperazine-1-carboxylate |
| InChIKey | XYDSFNOXAYIVAR-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(N1)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)