cas: 1196145-01-3 — see every product listed under this CAS number, including other names
Benzyl 3-amino-4-oxopiperidine-1-carboxylate hydrochloride 95% (CAS 1196145-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A307358-100mg |
| cas | 1196145-01-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2662.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A307358 |
Benzyl 3-amino-4-oxopiperidine-1-carboxylate;hydrochloride (CAS 1196145-01-3) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: benzyl 3-amino-4-oxopiperidine-1-carboxylate;hydrochloride. InChIKey: VXLMZPISJAADPN-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O3 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | benzyl 3-amino-4-oxopiperidine-1-carboxylate;hydrochloride |
| InChIKey | VXLMZPISJAADPN-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)