cas: 1196145-01-3 — see every product listed under this CAS number, including other names
Benzyl 3-amino-4-oxopiperidine-1-carboxylate hydrochloride, 97% (CAS 1196145-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224930-100MG |
| cas | 1196145-01-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 500mg | 383.22 Pln | |
| Fluorochem | 1g | 695.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 3-amino-4-oxopiperidine-1-carboxylate;hydrochloride (CAS 1196145-01-3) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: benzyl 3-amino-4-oxopiperidine-1-carboxylate;hydrochloride. InChIKey: VXLMZPISJAADPN-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O3 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | benzyl 3-amino-4-oxopiperidine-1-carboxylate;hydrochloride |
| InChIKey | VXLMZPISJAADPN-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)