cas: 174543-79-4 — see every product listed under this CAS number, including other names
Benzyl 3-carbamoyl-3-methylpiperidine-1-carboxylate, 97% (CAS 174543-79-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A760509-5g |
| cas | 174543-79-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5108.74 Pln | |
| AmBeed | 10g | 6163.36 Pln | |
| AmBeed | 25g | 10453.45 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 500mg | 612.30 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Fluorochem | 5g | 2976.05 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl 3-carbamoyl-3-methylpiperidine-1-carboxylate (CAS 174543-79-4) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: benzyl 3-carbamoyl-3-methylpiperidine-1-carboxylate. InChIKey: WGDHSFVEXLWNPV-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | benzyl 3-carbamoyl-3-methylpiperidine-1-carboxylate |
| InChIKey | WGDHSFVEXLWNPV-UHFFFAOYSA-N |
| SMILES | CC1(CCCN(C1)C(=O)OCC2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)