cas: 40983-94-6 — see every product listed under this CAS number, including other names
Benzyl 4,6-O-benzylidene-α-D-mannopyranoside (CAS 40983-94-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM03950C-10g |
| cas | 40983-94-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 9790.62 Pln | |
| Chemat | 1g | 2077.05 Pln | |
| Chemat | 2g | 3213.18 Pln | |
| Chemat | 5g | 6032.33 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
(4aR,6S,7S,8R,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (CAS 40983-94-6) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: (4aR,6S,7S,8R,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol. InChIKey: LEJLVYJUXVHIJN-LOZDCHMLSA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (4aR,6S,7S,8R,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| InChIKey | LEJLVYJUXVHIJN-LOZDCHMLSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H]([C@@H]([C@H](O2)OCC3=CC=CC=C3)O)O)OC(O1)C4=CC=CC=C4 |
Computed by PubChem (NCBI)