Products 546-97-4
CAS 546-97-4 appears in our catalog under these names: Columbin, 95%, Columbin, Columbin, >95% (HPLC), Columbin/ 99.74% (existing batch purity), Columbin, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, on request, 10mg, 1mg, 5mg, 25mg, 50mg, 10mM (in 1ml dmso).
(1S,2S,3S,5S,8R,11R,12S)-5-(furan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione (CAS 546-97-4) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: (1S,2S,3S,5S,8R,11R,12S)-5-(furan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione. InChIKey: AALLCALQGXXWNA-DURQJQQASA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (1S,2S,3S,5S,8R,11R,12S)-5-(furan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione |
| InChIKey | AALLCALQGXXWNA-DURQJQQASA-N |
| SMILES | C[C@@]12CC[C@H]3C(=O)O[C@@H](C[C@]3([C@@H]1[C@@H]4C=C[C@]2(C(=O)O4)O)C)C5=COC=C5 |
Computed by PubChem (NCBI)