cas: 58006-32-9 — see every product listed under this CAS number, including other names
Benzyl 4,6-O-benzylidene-β-D-glucopyranoside (CAS 58006-32-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 500mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM75430C-10g |
| cas | 58006-32-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 10087.95 Pln | |
| Chemat | 1g | 2077.05 Pln | |
| Chemat | 2g | 3165.07 Pln | |
| Chemat | 500mg | 1433.42 Pln | |
| Chemat | 5g | 6082.74 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
(4aR,6R,7R,8R,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (CAS 58006-32-9) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: (4aR,6R,7R,8R,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol. InChIKey: LEJLVYJUXVHIJN-YMUIMLINSA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (4aR,6R,7R,8R,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| InChIKey | LEJLVYJUXVHIJN-YMUIMLINSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OCC3=CC=CC=C3)O)O)OC(O1)C4=CC=CC=C4 |
Computed by PubChem (NCBI)