cas: 159275-17-9 — see every product listed under this CAS number, including other names
Benzyl 4-(Bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate 98% (CAS 159275-17-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A860813-250mg |
| cas | 159275-17-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 587.31 Pln | |
| Ambeed | 25g | 2295.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A860813 |
Benzyl 4-(bromomethyl)piperidine-1-carboxylate (CAS 159275-17-9) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: benzyl 4-(bromomethyl)piperidine-1-carboxylate. InChIKey: XJHKDSZGAWXUTB-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | benzyl 4-(bromomethyl)piperidine-1-carboxylate |
| InChIKey | XJHKDSZGAWXUTB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CBr)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)