cas: 1254115-22-4 — see every product listed under this CAS number, including other names
Benzyl 4-(oxetan-3-yl)piperazine-1-carboxylate 98% (CAS 1254115-22-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A284565-1g |
| cas | 1254115-22-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| Ambeed | 10g | 1482.88 Pln | |
| Ambeed | 25g | 2923.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A284565 |
Benzyl 4-(oxetan-3-yl)piperazine-1-carboxylate (CAS 1254115-22-4) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: benzyl 4-(oxetan-3-yl)piperazine-1-carboxylate. InChIKey: VJDWVTGQLRWGKY-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | benzyl 4-(oxetan-3-yl)piperazine-1-carboxylate |
| InChIKey | VJDWVTGQLRWGKY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2COC2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)