Benzyl 4-iodobenzoate, 96%
cas: 136618-42-3 — see every product listed under this CAS number, including other names
Benzyl 4-iodobenzoate, 96% (CAS 136618-42-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch112364-250mg |
| cas | 136618-42-3 |
| size | 250mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 573.20 Pln | |
| Chemat | 25g | 1331.60 Pln | |
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 456.11 Pln | |
| Fluorochem | 10g | 841.39 Pln | |
| Fluorochem | 25g | 1997.23 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-iodobenzoate (CAS 136618-42-3) is a chemical compound with the molecular formula C14H11IO2 and a molecular weight of 338.14 g/mol. IUPAC name: benzyl 4-iodobenzoate. InChIKey: MSSYFJWOCVCQJJ-UHFFFAOYSA-N.
| Molecular formula | C14H11IO2 |
|---|---|
| Molecular weight | 338.14 g/mol |
| IUPAC name | benzyl 4-iodobenzoate |
| InChIKey | MSSYFJWOCVCQJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)