cas: 1159825-47-4 — see every product listed under this CAS number, including other names
Benzyl 8-azabicyclo[3.2.1]octan-3-ylcarbamate, 97%, 97% (CAS 1159825-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11055L-100mg |
| cas | 1159825-47-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 947.60 Pln | |
| Chemat | 250mg | 1365.20 Pln | |
| Chemat | 500mg | 2142.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 1159825-47-4) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: benzyl 3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: GDXKRTUSJPSARB-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O2 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | benzyl 3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | GDXKRTUSJPSARB-UHFFFAOYSA-N |
| SMILES | C1CC2CC(CC1N2C(=O)OCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)