Products 1334499-75-0

CAS 1334499-75-0 is the registry number for 6-Cbz-1,6-diaza-spiro[3.5]nonane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 1,8-diazaspiro[3.5]nonane-8-carboxylate (CAS 1334499-75-0) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: benzyl 1,8-diazaspiro[3.5]nonane-8-carboxylate. InChIKey: FYWRMMWCCNOBSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N2O2
Molecular weight260.33 g/mol
IUPAC namebenzyl 1,8-diazaspiro[3.5]nonane-8-carboxylate
InChIKeyFYWRMMWCCNOBSJ-UHFFFAOYSA-N
SMILESC1CC2(CCN2)CN(C1)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)