cas: 2096332-60-2 — see every product listed under this CAS number, including other names
Benzyl propyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate, 97%, 97% (CAS 2096332-60-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHFK-250mg |
| cas | 2096332-60-2 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1490.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-propyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 2096332-60-2) is a chemical compound with the molecular formula C23H30BNO4 and a molecular weight of 395.3 g/mol. IUPAC name: benzyl N-propyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: WCPWANRWANWZPC-UHFFFAOYSA-N.
| Molecular formula | C23H30BNO4 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | benzyl N-propyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | WCPWANRWANWZPC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(CCC)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)