CAS 1218791-29-7 is the registry number for 4-(N-BOC-N-phenylamino)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl N-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1218791-29-7) is a chemical compound with the molecular formula C23H30BNO4 and a molecular weight of 395.3 g/mol. IUPAC name: tert-butyl N-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: WIGWVVIZEPRQNB-UHFFFAOYSA-N.
| Molecular formula | C23H30BNO4 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | tert-butyl N-phenyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | WIGWVVIZEPRQNB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(C3=CC=CC=C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)